C17H22ClIN4OS — CID 111259846
N-(3-chloro-2-methylphenyl)-3-[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111259846) has the molecular formula C17H22ClIN4OS and a molecular weight of 492.81 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111259846 |
| Molecular Formula | C17H22ClIN4OS |
| Molecular Weight | 492.81 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)Nc1cccc(Cl)c1C)NCc1cccs1.I |
| InChI | InChI=1S/C17H21ClN4OS.HI/c1-12-14(18)6-3-7-15(12)22-16(23)8-9-20-17(19-2)21-11-13-5-4-10-24-13;/h3-7,10H,8-9,11H2,1-2H3,(H,22,23)(H2,19,20,21);1H |
| InChIKey | WJORVLABDNVXKX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.81 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|