C24H27N5O7 — CID 10896340
4-N,5-N-dibenzyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazole-4,5-dicarboxamide (PubChem CID 10896340) has the molecular formula C24H27N5O7 and a molecular weight of 497.51 g/mol. Its IUPAC name is 4-N,5-N-dibenzyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazole-4,5-dicarboxamide.
| Compound Name | 4-N,5-N-dibenzyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 10896340 |
| Molecular Formula | C24H27N5O7 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 4-N,5-N-dibenzyl-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazole-4,5-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)c1nnn([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H27N5O7/c30-13-16-19(31)20(32)21(33)24(36-16)29-18(23(35)26-12-15-9-5-2-6-10-15)17(27-28-29)22(34)25-11-14-7-3-1-4-8-14/h1-10,16,19-21,24,30-33H,11-13H2,(H,25,34)(H,26,35)/t16-,19-,20+,21-,24-/m1/s1 |
| InChIKey | BDVVSFCVHUBRNN-OREFEKLXSA-N |
| XLogP | -0.89 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |