C22H27N3O4 — CID 108963674
3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3-oxo-N-(pyridin-4-ylmethyl)propanamide (PubChem CID 108963674) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3-oxo-N-(pyridin-4-ylmethyl)propanamide.
| Compound Name | 3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3-oxo-N-(pyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 108963674 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2,2-dimethyl-3-oxo-N-(pyridin-4-ylmethyl)propanamide |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)C(C)(C)C(=O)NCc1ccncc1)CC2 |
| InChI | InChI=1S/C22H27N3O4/c1-22(2,20(26)24-13-15-5-8-23-9-6-15)21(27)25-10-7-16-11-18(28-3)19(29-4)12-17(16)14-25/h5-6,8-9,11-12H,7,10,13-14H2,1-4H3,(H,24,26) |
| InChIKey | JRBRNBHHROWCNY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|