C20H24ClN3O2 — CID 108964558
N-(4-chloro-2-methylphenyl)-N',2,2-trimethyl-N'-(2-pyridin-4-ylethyl)propanediamide (PubChem CID 108964558) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-N',2,2-trimethyl-N'-(2-pyridin-4-ylethyl)propanediamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-N',2,2-trimethyl-N'-(2-pyridin-4-ylethyl)propanediamide |
|---|---|
| PubChem CID | 108964558 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-N',2,2-trimethyl-N'-(2-pyridin-4-ylethyl)propanediamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)C(C)(C)C(=O)N(C)CCc1ccncc1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-14-13-16(21)5-6-17(14)23-18(25)20(2,3)19(26)24(4)12-9-15-7-10-22-11-8-15/h5-8,10-11,13H,9,12H2,1-4H3,(H,23,25) |
| InChIKey | UWTTVRRPBXRLAZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|