C31H40O6 — CID 10896475
(1R,3S,5R,6S,8R,10S)-1,3,6-trimethyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-one (PubChem CID 10896475) has the molecular formula C31H40O6 and a molecular weight of 508.66 g/mol. Its IUPAC name is (1R,3S,5R,6S,8R,10S)-1,3,6-trimethyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-one.
| Compound Name | (1R,3S,5R,6S,8R,10S)-1,3,6-trimethyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-one |
|---|---|
| PubChem CID | 10896475 |
| Molecular Formula | C31H40O6 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | (1R,3S,5R,6S,8R,10S)-1,3,6-trimethyl-5-phenylmethoxy-6-(2-phenylmethoxyethyl)-2,7,11-trioxatricyclo[8.5.0.03,8]pentadecan-12-one |
| SMILES | C[C@@]12CCCC(=O)O[C@H]1C[C@H]1O[C@@](C)(CCOCc3ccccc3)[C@H](OCc3ccccc3)C[C@]1(C)O2 |
| InChI | InChI=1S/C31H40O6/c1-29(17-18-33-21-23-11-6-4-7-12-23)27(34-22-24-13-8-5-9-14-24)20-31(3)26(36-29)19-25-30(2,37-31)16-10-15-28(32)35-25/h4-9,11-14,25-27H,10,15-22H2,1-3H3/t25-,26+,27+,29-,30+,31-/m0/s1 |
| InChIKey | LNPIWGXKBMOFAS-BYBMCPGQSA-N |
| XLogP | 5.76 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|