C33H44O6 — CID 135048502
[(2R,3S,4aR,6S,7R)-6-[(Z)-but-2-enyl]-2,4a,6-trimethyl-3-phenylmethoxy-2-(2-phenylmethoxyethyl)-4,7,8,8a-tetrahydro-3H-pyrano[3,2-b]pyran-7-yl] acetate (PubChem CID 135048502) has the molecular formula C33H44O6 and a molecular weight of 536.71 g/mol. Its IUPAC name is [(2R,3S,4aR,6S,7R)-6-[(Z)-but-2-enyl]-2,4a,6-trimethyl-3-phenylmethoxy-2-(2-phenylmethoxyethyl)-4,7,8,8a-tetrahydro-3H-pyrano[3,2-b]pyran-7-yl] acetate.
| Compound Name | [(2R,3S,4aR,6S,7R)-6-[(Z)-but-2-enyl]-2,4a,6-trimethyl-3-phenylmethoxy-2-(2-phenylmethoxyethyl)-4,7,8,8a-tetrahydro-3H-pyrano[3,2-b]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 135048502 |
| Molecular Formula | C33H44O6 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | [(2R,3S,4aR,6S,7R)-6-[(Z)-but-2-enyl]-2,4a,6-trimethyl-3-phenylmethoxy-2-(2-phenylmethoxyethyl)-4,7,8,8a-tetrahydro-3H-pyrano[3,2-b]pyran-7-yl] acetate |
| SMILES | C/C=C\C[C@]1(C)O[C@]2(C)C[C@H](OCc3ccccc3)[C@@](C)(CCOCc3ccccc3)OC2C[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H44O6/c1-6-7-18-32(4)28(37-25(2)34)21-29-33(5,39-32)22-30(36-24-27-16-12-9-13-17-27)31(3,38-29)19-20-35-23-26-14-10-8-11-15-26/h6-17,28-30H,18-24H2,1-5H3/b7-6-/t28-,29?,30+,31-,32+,33-/m1/s1 |
| InChIKey | QMMSXEVPVWFZJC-CEQMKKCQSA-N |
| XLogP | 6.56 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|