C23H30N2O3 — CID 108969620
N-ethyl-2,2-dimethyl-N-(3-methylphenyl)-N'-(4-propan-2-yloxyphenyl)propanediamide (PubChem CID 108969620) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-N-(3-methylphenyl)-N'-(4-propan-2-yloxyphenyl)propanediamide.
| Compound Name | N-ethyl-2,2-dimethyl-N-(3-methylphenyl)-N'-(4-propan-2-yloxyphenyl)propanediamide |
|---|---|
| PubChem CID | 108969620 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | N-ethyl-2,2-dimethyl-N-(3-methylphenyl)-N'-(4-propan-2-yloxyphenyl)propanediamide |
| SMILES | CCN(C(=O)C(C)(C)C(=O)Nc1ccc(OC(C)C)cc1)c1cccc(C)c1 |
| InChI | InChI=1S/C23H30N2O3/c1-7-25(19-10-8-9-17(4)15-19)22(27)23(5,6)21(26)24-18-11-13-20(14-12-18)28-16(2)3/h8-16H,7H2,1-6H3,(H,24,26) |
| InChIKey | AXBQEMWQUSPODQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|