C27H31N3O6S2 — CID 10896986
2-[[2-(benzylamino)-2-oxoethyl]-(4-methoxyphenyl)sulfonylamino]-4-benzylsulfanyl-N-hydroxybutanamide (PubChem CID 10896986) has the molecular formula C27H31N3O6S2 and a molecular weight of 557.69 g/mol. Its IUPAC name is 2-[[2-(benzylamino)-2-oxoethyl]-(4-methoxyphenyl)sulfonylamino]-4-benzylsulfanyl-N-hydroxybutanamide.
| Compound Name | 2-[[2-(benzylamino)-2-oxoethyl]-(4-methoxyphenyl)sulfonylamino]-4-benzylsulfanyl-N-hydroxybutanamide |
|---|---|
| PubChem CID | 10896986 |
| Molecular Formula | C27H31N3O6S2 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 2-[[2-(benzylamino)-2-oxoethyl]-(4-methoxyphenyl)sulfonylamino]-4-benzylsulfanyl-N-hydroxybutanamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCc2ccccc2)C(CCSCc2ccccc2)C(=O)NO)cc1 |
| InChI | InChI=1S/C27H31N3O6S2/c1-36-23-12-14-24(15-13-23)38(34,35)30(19-26(31)28-18-21-8-4-2-5-9-21)25(27(32)29-33)16-17-37-20-22-10-6-3-7-11-22/h2-15,25,33H,16-20H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | MAOGHLYYLNCNCI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|