C16H16N4O3 — CID 108970171
N-(4-cyanophenyl)-2,2-dimethyl-N'-(5-methyl-1,2-oxazol-3-yl)propanediamide (PubChem CID 108970171) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2,2-dimethyl-N'-(5-methyl-1,2-oxazol-3-yl)propanediamide.
| Compound Name | N-(4-cyanophenyl)-2,2-dimethyl-N'-(5-methyl-1,2-oxazol-3-yl)propanediamide |
|---|---|
| PubChem CID | 108970171 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-(4-cyanophenyl)-2,2-dimethyl-N'-(5-methyl-1,2-oxazol-3-yl)propanediamide |
| SMILES | Cc1cc(NC(=O)C(C)(C)C(=O)Nc2ccc(C#N)cc2)no1 |
| InChI | InChI=1S/C16H16N4O3/c1-10-8-13(20-23-10)19-15(22)16(2,3)14(21)18-12-6-4-11(9-17)5-7-12/h4-8H,1-3H3,(H,18,21)(H,19,20,22) |
| InChIKey | RQEOWDDXHGZKBP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|