C20H29N3O3 — CID 108971255
1-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-N-(2-methylpropyl)cyclopropane-1-carboxamide (PubChem CID 108971255) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-N-(2-methylpropyl)cyclopropane-1-carboxamide.
| Compound Name | 1-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-N-(2-methylpropyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 108971255 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-N-(2-methylpropyl)cyclopropane-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)C3(C(=O)NCC(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C20H29N3O3/c1-15(2)14-21-18(24)20(8-9-20)19(25)23-12-10-22(11-13-23)16-4-6-17(26-3)7-5-16/h4-7,15H,8-14H2,1-3H3,(H,21,24) |
| InChIKey | DUKZOAHJLLAAMD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|