C23H27N3O3 — CID 108974600
N-(furan-2-ylmethyl)-1-[4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbonyl]cyclopropane-1-carboxamide (PubChem CID 108974600) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-[4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbonyl]cyclopropane-1-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-[4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbonyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 108974600 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-[4-[(E)-3-phenylprop-2-enyl]piperazine-1-carbonyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCc1ccco1)C1(C(=O)N2CCN(C/C=C/c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C23H27N3O3/c27-21(24-18-20-9-5-17-29-20)23(10-11-23)22(28)26-15-13-25(14-16-26)12-4-8-19-6-2-1-3-7-19/h1-9,17H,10-16,18H2,(H,24,27)/b8-4+ |
| InChIKey | ZHJGQLCVLATEFR-XBXARRHUSA-N |
| XLogP | 2.53 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|