C24H29N3O2 — CID 108977101
1-[4-(3-methylphenyl)piperazine-1-carbonyl]-N-(2-phenylethyl)cyclopropane-1-carboxamide (PubChem CID 108977101) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 1-[4-(3-methylphenyl)piperazine-1-carbonyl]-N-(2-phenylethyl)cyclopropane-1-carboxamide.
| Compound Name | 1-[4-(3-methylphenyl)piperazine-1-carbonyl]-N-(2-phenylethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 108977101 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 1-[4-(3-methylphenyl)piperazine-1-carbonyl]-N-(2-phenylethyl)cyclopropane-1-carboxamide |
| SMILES | Cc1cccc(N2CCN(C(=O)C3(C(=O)NCCc4ccccc4)CC3)CC2)c1 |
| InChI | InChI=1S/C24H29N3O2/c1-19-6-5-9-21(18-19)26-14-16-27(17-15-26)23(29)24(11-12-24)22(28)25-13-10-20-7-3-2-4-8-20/h2-9,18H,10-17H2,1H3,(H,25,28) |
| InChIKey | UXWNRHLSDFUIDZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|