C24H29N3O2 — CID 108978759
N-(2,4-dimethylphenyl)-1-[4-(3-methylphenyl)piperazine-1-carbonyl]cyclopropane-1-carboxamide (PubChem CID 108978759) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1-[4-(3-methylphenyl)piperazine-1-carbonyl]cyclopropane-1-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-1-[4-(3-methylphenyl)piperazine-1-carbonyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 108978759 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1-[4-(3-methylphenyl)piperazine-1-carbonyl]cyclopropane-1-carboxamide |
| SMILES | Cc1cccc(N2CCN(C(=O)C3(C(=O)Nc4ccc(C)cc4C)CC3)CC2)c1 |
| InChI | InChI=1S/C24H29N3O2/c1-17-5-4-6-20(16-17)26-11-13-27(14-12-26)23(29)24(9-10-24)22(28)25-21-8-7-18(2)15-19(21)3/h4-8,15-16H,9-14H2,1-3H3,(H,25,28) |
| InChIKey | LFALHXIVSLAMEB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|