C19H19F2N3O2 — CID 108977917
1-N-(2,6-difluorophenyl)-1-N'-methyl-1-N'-(2-pyridin-4-ylethyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108977917) has the molecular formula C19H19F2N3O2 and a molecular weight of 359.38 g/mol. Its IUPAC name is 1-N-(2,6-difluorophenyl)-1-N'-methyl-1-N'-(2-pyridin-4-ylethyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N-(2,6-difluorophenyl)-1-N'-methyl-1-N'-(2-pyridin-4-ylethyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108977917 |
| Molecular Formula | C19H19F2N3O2 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 1-N-(2,6-difluorophenyl)-1-N'-methyl-1-N'-(2-pyridin-4-ylethyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CN(CCc1ccncc1)C(=O)C1(C(=O)Nc2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C19H19F2N3O2/c1-24(12-7-13-5-10-22-11-6-13)18(26)19(8-9-19)17(25)23-16-14(20)3-2-4-15(16)21/h2-6,10-11H,7-9,12H2,1H3,(H,23,25) |
| InChIKey | RKXHLZFLGDDJDG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|