C16H20F2N2O2 — CID 108979974
1-N'-butyl-1-N-(2,6-difluorophenyl)-1-N'-methylcyclopropane-1,1-dicarboxamide (PubChem CID 108979974) has the molecular formula C16H20F2N2O2 and a molecular weight of 310.34 g/mol. Its IUPAC name is 1-N'-butyl-1-N-(2,6-difluorophenyl)-1-N'-methylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-butyl-1-N-(2,6-difluorophenyl)-1-N'-methylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108979974 |
| Molecular Formula | C16H20F2N2O2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-N'-butyl-1-N-(2,6-difluorophenyl)-1-N'-methylcyclopropane-1,1-dicarboxamide |
| SMILES | CCCCN(C)C(=O)C1(C(=O)Nc2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C16H20F2N2O2/c1-3-4-10-20(2)15(22)16(8-9-16)14(21)19-13-11(17)6-5-7-12(13)18/h5-7H,3-4,8-10H2,1-2H3,(H,19,21) |
| InChIKey | MJXJTVAIRYWCIN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|