C15H20FNO — CID 110415928
N-butyl-1-(2-fluorophenyl)-N-methylcyclopropane-1-carboxamide (PubChem CID 110415928) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is N-butyl-1-(2-fluorophenyl)-N-methylcyclopropane-1-carboxamide.
| Compound Name | N-butyl-1-(2-fluorophenyl)-N-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 110415928 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-butyl-1-(2-fluorophenyl)-N-methylcyclopropane-1-carboxamide |
| SMILES | CCCCN(C)C(=O)C1(c2ccccc2F)CC1 |
| InChI | InChI=1S/C15H20FNO/c1-3-4-11-17(2)14(18)15(9-10-15)12-7-5-6-8-13(12)16/h5-8H,3-4,9-11H2,1-2H3 |
| InChIKey | WMQUSIAIOILJEQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |