C23H31FN2O3 — CID 125162818
N-butyl-2-[(3R)-1-cyclohexyl-3-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-methylacetamide (PubChem CID 125162818) has the molecular formula C23H31FN2O3 and a molecular weight of 402.51 g/mol. Its IUPAC name is N-butyl-2-[(3R)-1-cyclohexyl-3-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-methylacetamide.
| Compound Name | N-butyl-2-[(3R)-1-cyclohexyl-3-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 125162818 |
| Molecular Formula | C23H31FN2O3 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | N-butyl-2-[(3R)-1-cyclohexyl-3-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-methylacetamide |
| SMILES | CCCCN(C)C(=O)C[C@]1(c2ccccc2F)CC(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C23H31FN2O3/c1-3-4-14-25(2)20(27)15-23(18-12-8-9-13-19(18)24)16-21(28)26(22(23)29)17-10-6-5-7-11-17/h8-9,12-13,17H,3-7,10-11,14-16H2,1-2H3/t23-/m1/s1 |
| InChIKey | YPRDCLIKSMJNKC-HSZRJFAPSA-N |
| XLogP | 3.80 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|