C28H31FN2O3 — CID 26278688
N-benzyl-2-[(3S)-1-cyclopentyl-3-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(cyclopropylmethyl)acetamide (PubChem CID 26278688) has the molecular formula C28H31FN2O3 and a molecular weight of 462.57 g/mol. Its IUPAC name is N-benzyl-2-[(3S)-1-cyclopentyl-3-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(cyclopropylmethyl)acetamide.
| Compound Name | N-benzyl-2-[(3S)-1-cyclopentyl-3-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(cyclopropylmethyl)acetamide |
|---|---|
| PubChem CID | 26278688 |
| Molecular Formula | C28H31FN2O3 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-benzyl-2-[(3S)-1-cyclopentyl-3-(2-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-(cyclopropylmethyl)acetamide |
| SMILES | O=C(C[C@@]1(c2ccccc2F)CC(=O)N(C2CCCC2)C1=O)N(Cc1ccccc1)CC1CC1 |
| InChI | InChI=1S/C28H31FN2O3/c29-24-13-7-6-12-23(24)28(17-26(33)31(27(28)34)22-10-4-5-11-22)16-25(32)30(19-21-14-15-21)18-20-8-2-1-3-9-20/h1-3,6-9,12-13,21-22H,4-5,10-11,14-19H2/t28-/m0/s1 |
| InChIKey | ZAEXZFGPWULJEY-NDEPHWFRSA-N |
| XLogP | 4.59 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|