C23H26N2O2 — CID 108981061
N-(2-tert-butylphenyl)-1-(2,3-dihydroindole-1-carbonyl)cyclopropane-1-carboxamide (PubChem CID 108981061) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-1-(2,3-dihydroindole-1-carbonyl)cyclopropane-1-carboxamide.
| Compound Name | N-(2-tert-butylphenyl)-1-(2,3-dihydroindole-1-carbonyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 108981061 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | N-(2-tert-butylphenyl)-1-(2,3-dihydroindole-1-carbonyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)C1(C(=O)N2CCc3ccccc32)CC1 |
| InChI | InChI=1S/C23H26N2O2/c1-22(2,3)17-9-5-6-10-18(17)24-20(26)23(13-14-23)21(27)25-15-12-16-8-4-7-11-19(16)25/h4-11H,12-15H2,1-3H3,(H,24,26) |
| InChIKey | DNDJTRWAGAAJEN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|