C20H20N2O3 — CID 108981079
1-(2,3-dihydroindole-1-carbonyl)-N-(3-methoxyphenyl)cyclopropane-1-carboxamide (PubChem CID 108981079) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-(2,3-dihydroindole-1-carbonyl)-N-(3-methoxyphenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(2,3-dihydroindole-1-carbonyl)-N-(3-methoxyphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 108981079 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 1-(2,3-dihydroindole-1-carbonyl)-N-(3-methoxyphenyl)cyclopropane-1-carboxamide |
| SMILES | COc1cccc(NC(=O)C2(C(=O)N3CCc4ccccc43)CC2)c1 |
| InChI | InChI=1S/C20H20N2O3/c1-25-16-7-4-6-15(13-16)21-18(23)20(10-11-20)19(24)22-12-9-14-5-2-3-8-17(14)22/h2-8,13H,9-12H2,1H3,(H,21,23) |
| InChIKey | AVUVBBZGJVDFFK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|