C23H24N2O2 — CID 108981201
3,4-dihydro-2H-quinolin-1-yl-[1-(2-methyl-2,3-dihydroindole-1-carbonyl)cyclopropyl]methanone (PubChem CID 108981201) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-yl-[1-(2-methyl-2,3-dihydroindole-1-carbonyl)cyclopropyl]methanone.
| Compound Name | 3,4-dihydro-2H-quinolin-1-yl-[1-(2-methyl-2,3-dihydroindole-1-carbonyl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 108981201 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-yl-[1-(2-methyl-2,3-dihydroindole-1-carbonyl)cyclopropyl]methanone |
| SMILES | CC1Cc2ccccc2N1C(=O)C1(C(=O)N2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C23H24N2O2/c1-16-15-18-8-3-5-11-20(18)25(16)22(27)23(12-13-23)21(26)24-14-6-9-17-7-2-4-10-19(17)24/h2-5,7-8,10-11,16H,6,9,12-15H2,1H3 |
| InChIKey | YTIHAQKNPPCTAC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|