C20H26N2O2 — CID 108980420
azepan-1-yl-[1-(3,4-dihydro-2H-quinoline-1-carbonyl)cyclopropyl]methanone (PubChem CID 108980420) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is azepan-1-yl-[1-(3,4-dihydro-2H-quinoline-1-carbonyl)cyclopropyl]methanone.
| Compound Name | azepan-1-yl-[1-(3,4-dihydro-2H-quinoline-1-carbonyl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 108980420 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | azepan-1-yl-[1-(3,4-dihydro-2H-quinoline-1-carbonyl)cyclopropyl]methanone |
| SMILES | O=C(N1CCCCCC1)C1(C(=O)N2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C20H26N2O2/c23-18(21-13-5-1-2-6-14-21)20(11-12-20)19(24)22-15-7-9-16-8-3-4-10-17(16)22/h3-4,8,10H,1-2,5-7,9,11-15H2 |
| InChIKey | HOCJCJQHHBZBLN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|