C20H27N3O3 — CID 108973642
1-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(2-morpholin-4-ylethyl)cyclopropane-1-carboxamide (PubChem CID 108973642) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(2-morpholin-4-ylethyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(2-morpholin-4-ylethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 108973642 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-(2-morpholin-4-ylethyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)C1(C(=O)N2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C20H27N3O3/c24-18(21-9-11-22-12-14-26-15-13-22)20(7-8-20)19(25)23-10-3-5-16-4-1-2-6-17(16)23/h1-2,4,6H,3,5,7-15H2,(H,21,24) |
| InChIKey | JMLDPTLDAJRORV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|