C22H23FN2O2 — CID 108977368
1-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-[2-(2-fluorophenyl)ethyl]cyclopropane-1-carboxamide (PubChem CID 108977368) has the molecular formula C22H23FN2O2 and a molecular weight of 366.44 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-[2-(2-fluorophenyl)ethyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-[2-(2-fluorophenyl)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 108977368 |
| Molecular Formula | C22H23FN2O2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinoline-1-carbonyl)-N-[2-(2-fluorophenyl)ethyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCCc1ccccc1F)C1(C(=O)N2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C22H23FN2O2/c23-18-9-3-1-6-16(18)11-14-24-20(26)22(12-13-22)21(27)25-15-5-8-17-7-2-4-10-19(17)25/h1-4,6-7,9-10H,5,8,11-15H2,(H,24,26) |
| InChIKey | POZONTAFJRFMAQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|