C18H19FN2O — CID 109000166
1-(2,3-dihydroindol-1-yl)-2-[2-(2-fluorophenyl)ethylamino]ethanone (PubChem CID 109000166) has the molecular formula C18H19FN2O and a molecular weight of 298.36 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-2-[2-(2-fluorophenyl)ethylamino]ethanone.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-2-[2-(2-fluorophenyl)ethylamino]ethanone |
|---|---|
| PubChem CID | 109000166 |
| Molecular Formula | C18H19FN2O |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-2-[2-(2-fluorophenyl)ethylamino]ethanone |
| SMILES | O=C(CNCCc1ccccc1F)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H19FN2O/c19-16-7-3-1-5-14(16)9-11-20-13-18(22)21-12-10-15-6-2-4-8-17(15)21/h1-8,20H,9-13H2 |
| InChIKey | IFEVNPSHQHZUEF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|