C23H27N3O2 — CID 108981349
1-N'-(2,5-dimethylphenyl)-1-N-(4-pyrrolidin-1-ylphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108981349) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-N'-(2,5-dimethylphenyl)-1-N-(4-pyrrolidin-1-ylphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(2,5-dimethylphenyl)-1-N-(4-pyrrolidin-1-ylphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108981349 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-N'-(2,5-dimethylphenyl)-1-N-(4-pyrrolidin-1-ylphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C2(C(=O)Nc3ccc(N4CCCC4)cc3)CC2)c1 |
| InChI | InChI=1S/C23H27N3O2/c1-16-5-6-17(2)20(15-16)25-22(28)23(11-12-23)21(27)24-18-7-9-19(10-8-18)26-13-3-4-14-26/h5-10,15H,3-4,11-14H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | SAZSYLNNOROVFQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|