C24H29N3O2 — CID 108981506
1-N'-(3,5-dimethylphenyl)-1-N-(4-piperidin-1-ylphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108981506) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 1-N'-(3,5-dimethylphenyl)-1-N-(4-piperidin-1-ylphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(3,5-dimethylphenyl)-1-N-(4-piperidin-1-ylphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108981506 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 1-N'-(3,5-dimethylphenyl)-1-N-(4-piperidin-1-ylphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)C2(C(=O)Nc3ccc(N4CCCCC4)cc3)CC2)c1 |
| InChI | InChI=1S/C24H29N3O2/c1-17-14-18(2)16-20(15-17)26-23(29)24(10-11-24)22(28)25-19-6-8-21(9-7-19)27-12-4-3-5-13-27/h6-9,14-16H,3-5,10-13H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | DOJHHTGCPFKCJG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|