C24H24N2O3 — CID 108985483
N'-benzyl-N-[2-(3-methoxyphenyl)ethyl]-N'-phenyloxamide (PubChem CID 108985483) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is N'-benzyl-N-[2-(3-methoxyphenyl)ethyl]-N'-phenyloxamide.
| Compound Name | N'-benzyl-N-[2-(3-methoxyphenyl)ethyl]-N'-phenyloxamide |
|---|---|
| PubChem CID | 108985483 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N'-benzyl-N-[2-(3-methoxyphenyl)ethyl]-N'-phenyloxamide |
| SMILES | COc1cccc(CCNC(=O)C(=O)N(Cc2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H24N2O3/c1-29-22-14-8-11-19(17-22)15-16-25-23(27)24(28)26(21-12-6-3-7-13-21)18-20-9-4-2-5-10-20/h2-14,17H,15-16,18H2,1H3,(H,25,27) |
| InChIKey | OXVIMVHABWSHFA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|