C10H21NS — CID 10899390
trans-(1R,2R)-2-tert-butylsulfanylcyclohexan-1-amine (PubChem CID 10899390) has the molecular formula C10H21NS and a molecular weight of 187.35 g/mol. Its IUPAC name is trans-(1R,2R)-2-tert-butylsulfanylcyclohexan-1-amine.
| Compound Name | trans-(1R,2R)-2-tert-butylsulfanylcyclohexan-1-amine |
|---|---|
| PubChem CID | 10899390 |
| Molecular Formula | C10H21NS |
| Molecular Weight | 187.35 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | trans-(1R,2R)-2-tert-butylsulfanylcyclohexan-1-amine |
| SMILES | CC(C)(C)S[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C10H21NS/c1-10(2,3)12-9-7-5-4-6-8(9)11/h8-9H,4-7,11H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | LJPVITVOCYXHSF-RKDXNWHRSA-N |
| XLogP | 2.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |