C7H15NS — CID 12770090
trans-(1R,2R)-2-methylsulfanylcyclohexan-1-amine (PubChem CID 12770090) has the molecular formula C7H15NS and a molecular weight of 145.27 g/mol. Its IUPAC name is trans-(1R,2R)-2-methylsulfanylcyclohexan-1-amine.
| Compound Name | trans-(1R,2R)-2-methylsulfanylcyclohexan-1-amine |
|---|---|
| PubChem CID | 12770090 |
| Molecular Formula | C7H15NS |
| Molecular Weight | 145.27 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | trans-(1R,2R)-2-methylsulfanylcyclohexan-1-amine |
| SMILES | CS[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C7H15NS/c1-9-7-5-3-2-4-6(7)8/h6-7H,2-5,8H2,1H3/t6-,7-/m1/s1 |
| InChIKey | FYQACJYFRNDZMT-RNFRBKRXSA-N |
| XLogP | 1.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |