C18H19F3N2O2 — CID 109001307
N-[2-(4-methoxyphenyl)ethyl]-2-[2-(trifluoromethyl)anilino]acetamide (PubChem CID 109001307) has the molecular formula C18H19F3N2O2 and a molecular weight of 352.36 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-2-[2-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-2-[2-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 109001307 |
| Molecular Formula | C18H19F3N2O2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-2-[2-(trifluoromethyl)anilino]acetamide |
| SMILES | COc1ccc(CCNC(=O)CNc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3N2O2/c1-25-14-8-6-13(7-9-14)10-11-22-17(24)12-23-16-5-3-2-4-15(16)18(19,20)21/h2-9,23H,10-12H2,1H3,(H,22,24) |
| InChIKey | ICLVHDGTMBNMIL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |