C17H16F4N2O — CID 109000338
N-[2-(2-fluorophenyl)ethyl]-2-[2-(trifluoromethyl)anilino]acetamide (PubChem CID 109000338) has the molecular formula C17H16F4N2O and a molecular weight of 340.32 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-2-[2-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-2-[2-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 109000338 |
| Molecular Formula | C17H16F4N2O |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-2-[2-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1ccccc1C(F)(F)F)NCCc1ccccc1F |
| InChI | InChI=1S/C17H16F4N2O/c18-14-7-3-1-5-12(14)9-10-22-16(24)11-23-15-8-4-2-6-13(15)17(19,20)21/h1-8,23H,9-11H2,(H,22,24) |
| InChIKey | DJFOEJXPPWABGI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |