C12H14F4N2O — CID 60646650
2-[2-(2-fluorophenyl)ethylamino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 60646650) has the molecular formula C12H14F4N2O and a molecular weight of 278.25 g/mol. Its IUPAC name is 2-[2-(2-fluorophenyl)ethylamino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[2-(2-fluorophenyl)ethylamino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 60646650 |
| Molecular Formula | C12H14F4N2O |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2-[2-(2-fluorophenyl)ethylamino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CNCCc1ccccc1F)NCC(F)(F)F |
| InChI | InChI=1S/C12H14F4N2O/c13-10-4-2-1-3-9(10)5-6-17-7-11(19)18-8-12(14,15)16/h1-4,17H,5-8H2,(H,18,19) |
| InChIKey | AOLVLRIXVYYLSS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|