C17H16FN3O — CID 109000386
2-(2-cyanoanilino)-N-[2-(2-fluorophenyl)ethyl]acetamide (PubChem CID 109000386) has the molecular formula C17H16FN3O and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-(2-cyanoanilino)-N-[2-(2-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-(2-cyanoanilino)-N-[2-(2-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 109000386 |
| Molecular Formula | C17H16FN3O |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-(2-cyanoanilino)-N-[2-(2-fluorophenyl)ethyl]acetamide |
| SMILES | N#Cc1ccccc1NCC(=O)NCCc1ccccc1F |
| InChI | InChI=1S/C17H16FN3O/c18-15-7-3-1-5-13(15)9-10-20-17(22)12-21-16-8-4-2-6-14(16)11-19/h1-8,21H,9-10,12H2,(H,20,22) |
| InChIKey | RXRURYAPRTUJBT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |