C18H18ClF2N3O — CID 109004385
1-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2,4-difluoroanilino)ethanone (PubChem CID 109004385) has the molecular formula C18H18ClF2N3O and a molecular weight of 365.81 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2,4-difluoroanilino)ethanone.
| Compound Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2,4-difluoroanilino)ethanone |
|---|---|
| PubChem CID | 109004385 |
| Molecular Formula | C18H18ClF2N3O |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-2-(2,4-difluoroanilino)ethanone |
| SMILES | O=C(CNc1ccc(F)cc1F)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H18ClF2N3O/c19-13-2-1-3-15(10-13)23-6-8-24(9-7-23)18(25)12-22-17-5-4-14(20)11-16(17)21/h1-5,10-11,22H,6-9,12H2 |
| InChIKey | VIHWMBSWTLTCSF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |