C12H14F2N2O2 — CID 28582837
2-(2,4-difluoroanilino)-1-morpholin-4-ylethanone (PubChem CID 28582837) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is 2-(2,4-difluoroanilino)-1-morpholin-4-ylethanone.
| Compound Name | 2-(2,4-difluoroanilino)-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 28582837 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-(2,4-difluoroanilino)-1-morpholin-4-ylethanone |
| SMILES | O=C(CNc1ccc(F)cc1F)N1CCOCC1 |
| InChI | InChI=1S/C12H14F2N2O2/c13-9-1-2-11(10(14)7-9)15-8-12(17)16-3-5-18-6-4-16/h1-2,7,15H,3-6,8H2 |
| InChIKey | MJKAFSXFZPLMHX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |