C12H12F4N2O2 — CID 107644421
1-morpholin-4-yl-2-(2,3,5,6-tetrafluoroanilino)ethanone (PubChem CID 107644421) has the molecular formula C12H12F4N2O2 and a molecular weight of 292.23 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-(2,3,5,6-tetrafluoroanilino)ethanone.
| Compound Name | 1-morpholin-4-yl-2-(2,3,5,6-tetrafluoroanilino)ethanone |
|---|---|
| PubChem CID | 107644421 |
| Molecular Formula | C12H12F4N2O2 |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-morpholin-4-yl-2-(2,3,5,6-tetrafluoroanilino)ethanone |
| SMILES | O=C(CNc1c(F)c(F)cc(F)c1F)N1CCOCC1 |
| InChI | InChI=1S/C12H12F4N2O2/c13-7-5-8(14)11(16)12(10(7)15)17-6-9(19)18-1-3-20-4-2-18/h5,17H,1-4,6H2 |
| InChIKey | PIAWQCBPXHXBEF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|