C13H15BrF2N2O — CID 65467650
2-(4-bromo-2,6-difluoroanilino)-1-piperidin-1-ylethanone (PubChem CID 65467650) has the molecular formula C13H15BrF2N2O and a molecular weight of 333.18 g/mol. Its IUPAC name is 2-(4-bromo-2,6-difluoroanilino)-1-piperidin-1-ylethanone.
| Compound Name | 2-(4-bromo-2,6-difluoroanilino)-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 65467650 |
| Molecular Formula | C13H15BrF2N2O |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 2-(4-bromo-2,6-difluoroanilino)-1-piperidin-1-ylethanone |
| SMILES | O=C(CNc1c(F)cc(Br)cc1F)N1CCCCC1 |
| InChI | InChI=1S/C13H15BrF2N2O/c14-9-6-10(15)13(11(16)7-9)17-8-12(19)18-4-2-1-3-5-18/h6-7,17H,1-5,8H2 |
| InChIKey | OBDOIAPKOJMRFG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |