C15H28N2 — CID 10900638
1-[(4aS,5R,8aR)-5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-tert-butylmethanimine (PubChem CID 10900638) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 1-[(4aS,5R,8aR)-5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-tert-butylmethanimine.
| Compound Name | 1-[(4aS,5R,8aR)-5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-tert-butylmethanimine |
|---|---|
| PubChem CID | 10900638 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 1-[(4aS,5R,8aR)-5-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-N-tert-butylmethanimine |
| SMILES | C[C@@H]1CCC[C@@H]2[C@H]1CCCN2/C=N/C(C)(C)C |
| InChI | InChI=1S/C15H28N2/c1-12-7-5-9-14-13(12)8-6-10-17(14)11-16-15(2,3)4/h11-14H,5-10H2,1-4H3/b16-11+/t12-,13+,14-/m1/s1 |
| InChIKey | AWKDFSVPEFJWRN-VKXUYIDRSA-N |
| XLogP | 3.71 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|