C16H32N2 — CID 171106634
N,5-dimethyl-1-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-imine;ethane (PubChem CID 171106634) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is N,5-dimethyl-1-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-imine;ethane.
| Compound Name | N,5-dimethyl-1-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-imine;ethane |
|---|---|
| PubChem CID | 171106634 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | N,5-dimethyl-1-propan-2-yl-3,4,4a,5,6,7,8,8a-octahydroquinolin-2-imine;ethane |
| SMILES | C/N=C1\CCC2C(C)CCCC2N1C(C)C.CC |
| InChI | InChI=1S/C14H26N2.C2H6/c1-10(2)16-13-7-5-6-11(3)12(13)8-9-14(16)15-4;1-2/h10-13H,5-9H2,1-4H3;1-2H3/b15-14+; |
| InChIKey | MUGIBNAODNHXFY-WPDLWGESSA-N |
| XLogP | 4.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|