C18H35N3 — CID 91336684
4-[1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethylideneamino]-2,4-dimethylpentan-2-amine (PubChem CID 91336684) has the molecular formula C18H35N3 and a molecular weight of 293.50 g/mol. Its IUPAC name is 4-[1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethylideneamino]-2,4-dimethylpentan-2-amine.
| Compound Name | 4-[1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethylideneamino]-2,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 91336684 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | 4-[1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethylideneamino]-2,4-dimethylpentan-2-amine |
| SMILES | C/C(=N\C(C)(C)CC(C)(C)N)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C18H35N3/c1-14(20-18(4,5)13-17(2,3)19)21-12-8-10-15-9-6-7-11-16(15)21/h15-16H,6-13,19H2,1-5H3/b20-14+ |
| InChIKey | HMYOGJWNHBYVBC-XSFVSMFZSA-N |
| XLogP | 3.97 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|