C14H22O3 — CID 10900693
1-[(2R)-2-[(E,2S)-6-methoxy-6-methylhept-4-en-2-yl]oxiran-2-yl]prop-2-en-1-one (PubChem CID 10900693) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-[(2R)-2-[(E,2S)-6-methoxy-6-methylhept-4-en-2-yl]oxiran-2-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R)-2-[(E,2S)-6-methoxy-6-methylhept-4-en-2-yl]oxiran-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 10900693 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 1-[(2R)-2-[(E,2S)-6-methoxy-6-methylhept-4-en-2-yl]oxiran-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)[C@@]1([C@@H](C)C/C=C/C(C)(C)OC)CO1 |
| InChI | InChI=1S/C14H22O3/c1-6-12(15)14(10-17-14)11(2)8-7-9-13(3,4)16-5/h6-7,9,11H,1,8,10H2,2-5H3/b9-7+/t11-,14-/m0/s1 |
| InChIKey | LSFVSHRMDINQCQ-JVQPOWMJSA-N |
| XLogP | 2.52 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|