C11H16O2 — CID 121223694
1-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-4-en-1-yl)ethanone (PubChem CID 121223694) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-4-en-1-yl)ethanone.
| Compound Name | 1-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-4-en-1-yl)ethanone |
|---|---|
| PubChem CID | 121223694 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 1-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-4-en-1-yl)ethanone |
| SMILES | CC(=O)C12OC1(C)C=CCC2(C)C |
| InChI | InChI=1S/C11H16O2/c1-8(12)11-9(2,3)6-5-7-10(11,4)13-11/h5,7H,6H2,1-4H3 |
| InChIKey | HJBSMHJDZILSHB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|