C13H16O3 — CID 5363805
2,2,6-trimethyl-1-[(E)-3-oxobut-1-enyl]-7-oxabicyclo[4.1.0]hept-4-en-3-one (PubChem CID 5363805) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2,2,6-trimethyl-1-[(E)-3-oxobut-1-enyl]-7-oxabicyclo[4.1.0]hept-4-en-3-one.
| Compound Name | 2,2,6-trimethyl-1-[(E)-3-oxobut-1-enyl]-7-oxabicyclo[4.1.0]hept-4-en-3-one |
|---|---|
| PubChem CID | 5363805 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2,2,6-trimethyl-1-[(E)-3-oxobut-1-enyl]-7-oxabicyclo[4.1.0]hept-4-en-3-one |
| SMILES | CC(=O)/C=C/C12OC1(C)C=CC(=O)C2(C)C |
| InChI | InChI=1S/C13H16O3/c1-9(14)5-8-13-11(2,3)10(15)6-7-12(13,4)16-13/h5-8H,1-4H3/b8-5+ |
| InChIKey | OQJIRPICKJYVES-VMPITWQZSA-N |
| XLogP | 1.82 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|