C15H28O2 — CID 143197082
ethane;6-ethyl-1,5-dimethyl-7-oxabicyclo[4.1.0]hept-4-en-3-one;propane (PubChem CID 143197082) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is ethane;6-ethyl-1,5-dimethyl-7-oxabicyclo[4.1.0]hept-4-en-3-one;propane.
| Compound Name | ethane;6-ethyl-1,5-dimethyl-7-oxabicyclo[4.1.0]hept-4-en-3-one;propane |
|---|---|
| PubChem CID | 143197082 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | ethane;6-ethyl-1,5-dimethyl-7-oxabicyclo[4.1.0]hept-4-en-3-one;propane |
| SMILES | CC.CCC.CCC12OC1(C)CC(=O)C=C2C |
| InChI | InChI=1S/C10H14O2.C3H8.C2H6/c1-4-10-7(2)5-8(11)6-9(10,3)12-10;1-3-2;1-2/h5H,4,6H2,1-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | UIAPSTOSULNGEO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|