C12H14O3 — CID 130436895
(6R)-1,5-dimethyl-6-[(E)-3-oxobut-1-enyl]-7-oxabicyclo[4.1.0]hept-4-en-3-one (PubChem CID 130436895) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (6R)-1,5-dimethyl-6-[(E)-3-oxobut-1-enyl]-7-oxabicyclo[4.1.0]hept-4-en-3-one.
| Compound Name | (6R)-1,5-dimethyl-6-[(E)-3-oxobut-1-enyl]-7-oxabicyclo[4.1.0]hept-4-en-3-one |
|---|---|
| PubChem CID | 130436895 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (6R)-1,5-dimethyl-6-[(E)-3-oxobut-1-enyl]-7-oxabicyclo[4.1.0]hept-4-en-3-one |
| SMILES | CC(=O)/C=C/[C@]12OC1(C)CC(=O)C=C2C |
| InChI | InChI=1S/C12H14O3/c1-8-6-10(14)7-11(3)12(8,15-11)5-4-9(2)13/h4-6H,7H2,1-3H3/b5-4+/t11?,12-/m1/s1 |
| InChIKey | PDRZLYJKCIKVLP-XQCSSWMESA-N |
| XLogP | 1.58 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|