C11H16O2 — CID 102235030
2,2,4,4,7-pentamethyl-1-oxaspiro[2.4]hept-6-en-5-one (PubChem CID 102235030) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2,2,4,4,7-pentamethyl-1-oxaspiro[2.4]hept-6-en-5-one.
| Compound Name | 2,2,4,4,7-pentamethyl-1-oxaspiro[2.4]hept-6-en-5-one |
|---|---|
| PubChem CID | 102235030 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2,2,4,4,7-pentamethyl-1-oxaspiro[2.4]hept-6-en-5-one |
| SMILES | CC1=CC(=O)C(C)(C)C12OC2(C)C |
| InChI | InChI=1S/C11H16O2/c1-7-6-8(12)9(2,3)11(7)10(4,5)13-11/h6H,1-5H3 |
| InChIKey | RLAOVZRXKHLXOB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|