C12H18O2 — CID 10774196
(1S,6R)-1,2,2,4,5,6-hexamethyl-7-oxabicyclo[4.1.0]hept-4-en-3-one (PubChem CID 10774196) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (1S,6R)-1,2,2,4,5,6-hexamethyl-7-oxabicyclo[4.1.0]hept-4-en-3-one.
| Compound Name | (1S,6R)-1,2,2,4,5,6-hexamethyl-7-oxabicyclo[4.1.0]hept-4-en-3-one |
|---|---|
| PubChem CID | 10774196 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (1S,6R)-1,2,2,4,5,6-hexamethyl-7-oxabicyclo[4.1.0]hept-4-en-3-one |
| SMILES | CC1=C(C)[C@@]2(C)O[C@@]2(C)C(C)(C)C1=O |
| InChI | InChI=1S/C12H18O2/c1-7-8(2)11(5)12(6,14-11)10(3,4)9(7)13/h1-6H3/t11-,12+/m1/s1 |
| InChIKey | UAGXTSPZMIYODP-NEPJUHHUSA-N |
| XLogP | 2.48 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|