C13H16O4 — CID 5363636
[(E)-2-(2,2,6-trimethyl-3-oxo-7-oxabicyclo[4.1.0]hept-4-en-1-yl)ethenyl] acetate (PubChem CID 5363636) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is [(E)-2-(2,2,6-trimethyl-3-oxo-7-oxabicyclo[4.1.0]hept-4-en-1-yl)ethenyl] acetate.
| Compound Name | [(E)-2-(2,2,6-trimethyl-3-oxo-7-oxabicyclo[4.1.0]hept-4-en-1-yl)ethenyl] acetate |
|---|---|
| PubChem CID | 5363636 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | [(E)-2-(2,2,6-trimethyl-3-oxo-7-oxabicyclo[4.1.0]hept-4-en-1-yl)ethenyl] acetate |
| SMILES | CC(=O)O/C=C/C12OC1(C)C=CC(=O)C2(C)C |
| InChI | InChI=1S/C13H16O4/c1-9(14)16-8-7-13-11(2,3)10(15)5-6-12(13,4)17-13/h5-8H,1-4H3/b8-7+ |
| InChIKey | OIAKVBXBQCBZSB-BQYQJAHWSA-N |
| XLogP | 1.76 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|