C14H20O2 — CID 5372302
(E)-4-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-4-en-1-yl)pent-3-en-2-one (PubChem CID 5372302) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (E)-4-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-4-en-1-yl)pent-3-en-2-one.
| Compound Name | (E)-4-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-4-en-1-yl)pent-3-en-2-one |
|---|---|
| PubChem CID | 5372302 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (E)-4-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-4-en-1-yl)pent-3-en-2-one |
| SMILES | CC(=O)/C=C(\C)C12OC1(C)C=CCC2(C)C |
| InChI | InChI=1S/C14H20O2/c1-10(9-11(2)15)14-12(3,4)7-6-8-13(14,5)16-14/h6,8-9H,7H2,1-5H3/b10-9+ |
| InChIKey | LJJDCNNSHZJFGU-MDZDMXLPSA-N |
| XLogP | 3.04 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|